|
| Home | Crystal | jmol | jPOWD | Chem | X Ray | Dana | Strunz | Properties | A to Z | Images | Share | News | Help | About |
Minerals Arranged by X-Ray Powder Diffraction
See Help on X-Ray Diffraction.
Powder X-ray Diffraction (XRD) is one of the primary techniques used by mineralogists and solid state chemists to examine the physico-chemical make-up of unknown materials. This data is represented in a collection of single-phase X-ray powder diffraction patterns for the three most intense D values in the form of tables of interplanar spacings (D), relative intensities (I/Io), mineral name and chemical formulae
The XRD technique takes a sample of the material and places a powdered sample in a holder, then the sample is illuminated with x-rays of a fixed wave-length and the intensity of the reflected radiation is recorded using a goniometer. This data is then analyzed for the reflection angle to calculate the inter-atomic spacing (D value in Angstrom units - 10-8 cm). The intensity(I) is measured to discriminate (using I ratios) the various D spacings and the results are compared to this table to identify possible matches. Note: 2 theta (Θ) angle calculated from the Bragg Equation, 2 Θ = 2(arcsin(n λ/(2d)) where n=1;
For more information about this technique, see X-Ray Analysis of a Solid or take an internet course at Birkbeck College On-line Courses. Many thanks to Frederic Biret for these data.
[ 1 ]
| D1 Å (2θ) |
I1 %) |
D2 Å (2θ) |
I2 (%) |
D3 Å (2θ) |
I3 (%) |
Mineral | Formula |
| 10.600(8.33) | 100 | 3.510(25.35) | 80 | 2.770(32.29) | 60 | Astrophyllite | K2Na(Fe++,Mn)7Ti2Si8O26(OH)4 |
| 10.600(8.33) | 100 | 5.860(15.11) | 90 | 6.340(13.96) | 60 | Dypingite | Mg5(CO3)4(OH)2•5(H2O) |
| 10.640(8.30) | 100 | 5.440(16.28) | 70 | 4.570(19.41) | 60 | Rankachite | CaFe++V+++++4W++++++8O36•12(H2O) |
| 10.670(8.28) | 100 | 3.560(24.99) | 18 | 3.173(28.10) | 13 | IMA2008-010 | CaCu4(AsO4)2(AsO3OH)2•10H2O |
| 10.680(8.27) | 100 | 5.340(16.59) | 60 | 3.560(24.99) | 44 | Campigliaite | Cu4Mn(SO4)2(OH)6•4(H2O) |
| 10.680(8.27) | 100 | 1.840(49.50) | 80 | 3.480(25.58) | 30 | Fernandinite | CaV8O20•4(H2O) |
| 10.690(8.26) | 100 | 3.051(29.25) | 80 | 3.121(28.58) | 80 | George-ericksenite | Na6CaMg(IO3)6(CrO4)2•12(H2O) |
| 10.690(8.26) | 100 | 3.121(28.58) | 80 | 3.051(29.25) | 80 | George-ericksenite | Na6CaMg(IO3)6(CrO4)2•12(H2O) |
| 10.700(8.26) | 100 | 2.950(30.27) | 50 | 3.490(25.50) | 40 | Rauvite | Ca(UO2)2V+++++10O28•16(H2O) |
| 10.700(8.26) | 100 | 8.520(10.37) | 40 | 7.900(11.19) | 35 | Vanalite | NaAl8V10O38•30(H2O) |
| 10.700(8.26) | 100 | 9.070(9.74) | 100 | 3.030(29.45) | 30 | Wightmanite | Mg5(BO3)O(OH)5•2(H2O) |
| 10.707(8.25) | 100 | 2.587(34.65) | 50 | 2.793(32.02) | 40 | Niobokupletskite | K2Na(Mn,Zn,Fe)7(Nb,Zr,Ti)2Si8O26(OH)4(O,F) |
| 10.707(8.25) | 100 | 3.536(25.16) | 50 | 2.587(34.65) | 40 | Niobokupletskite | K2Na(Mn,Zn,Fe)7(Nb,Zr,Ti)2Si8O26(OH)4(O,F) |
| 10.720(8.24) | 100 | 3.570(24.92) | 80 | 2.016(44.93) | 35 | Girvasite | NaCa2Mg3(PO4)2[PO2(OH)2](CO3)(OH)2•4(H2O) |
| 10.726(8.24) | 100 | 3.013(29.62) | 60 | 6.024(14.69) | 50 | Creaseyite | Pb2Cu2(Fe+++,Al)2Si5O17•6(H2O) |
| 10.730(8.23) | 100 | 2.451(36.63) | 80 | 2.938(30.40) | 80 | Agardite-(Y) | (Y,Ca)Cu6(AsO4)3(OH)6•3(H2O) |
| 10.730(8.23) | 100 | 2.938(30.40) | 80 | 2.451(36.63) | 80 | Agardite-(Y) | (Y,Ca)Cu6(AsO4)3(OH)6•3(H2O) |
| 10.770(8.20) | 100 | 4.130(21.50) | 55 | 5.280(16.78) | 38 | Sanjuanite | Al2(PO4)(SO4)(OH)•9(H2O) |
| 10.790(8.19) | 100 | 8.120(10.89) | 80 | 6.100(14.51) | 70 | Partheite | Ca2Al4Si4O15(OH)2•4(H2O) |
| 10.800(8.18) | 100 | 2.410(37.28) | 100 | 1.390(67.31) | 100 | Glucine | CaBe4(PO4)2(OH)4•0.5(H2O) |
| 10.800(8.18) | 100 | 2.888(30.94) | 31 | 3.083(28.94) | 28 | Delindeite | Ba2(Na,K,[ ])3(Ti,Fe)[Ti2(O,OH)4Si4O14](H2O,OH)2 |
| 10.800(8.18) | 100 | 3.300(27.00) | 90 | 2.725(32.84) | 60 | Guarinoite | (Zn,Co,Ni)6(SO4)(OH,Cl)10•5(H2O) |
| 10.800(8.18) | 100 | 3.360(26.51) | 80 | 2.440(36.80) | 60 | Rauenthalite | Ca3(AsO4)2•10(H2O) |
| 10.800(8.18) | 100 | 11.690(7.56) | 80 | 2.931(30.47) | 70 | Moreauite | Al3(UO2)(PO4)3(OH)2•13(H2O) |
| 10.810(8.17) | 100 | 10.840(8.15) | 100 | 2.831(31.58) | 90 | Ferrarisite | Ca5(AsO3OH)2(AsO4)2•9(H2O) |
| 10.810(8.17) | 100 | 1.937(46.86) | 5 | 3.590(24.78) | 5 | Corvusite | (Na,Ca,K)V8O20•4(H2O) |
| 10.810(8.17) | 100 | 3.590(24.78) | 5 | 1.937(46.86) | 5 | Corvusite | (Na,Ca,K)V8O20•4(H2O) |
| 10.820(8.16) | 100 | 2.235(40.32) | 40 | 2.510(35.74) | 30 | Tuperssuatsiaite | Na(Fe+++,Mn)3[Si8O20](OH)2•n(H2O) |
| 10.820(8.16) | 100 | 2.638(33.95) | 40 | 2.235(40.32) | 30 | Tuperssuatsiaite | Na(Fe+++,Mn)3[Si8O20](OH)2•n(H2O) |
| 10.840(8.15) | 100 | 10.810(8.17) | 100 | 2.831(31.58) | 90 | Ferrarisite | Ca5(AsO3OH)2(AsO4)2•9(H2O) |
| 10.850(8.14) | 100 | 3.625(24.54) | 60 | 5.440(16.28) | 50 | Leogangite | Cu10(AsO4)4(SO4)(OH)6•8(H2O) |
| 10.850(8.14) | 100 | 5.457(16.23) | 20 | 5.908(14.98) | 12 | Vauxite | Fe++Al2(PO4)2(OH)2•6(H2O) |
| 10.850(8.14) | 100 | 2.630(34.06) | 60 | 3.625(24.54) | 50 | Leogangite | Cu10(AsO4)4(SO4)(OH)6•8(H2O) |
| 10.870(8.13) | 100 | 3.160(28.22) | 70 | 2.880(31.03) | 60 | Smolianinovite | (Co,Ni,Mg,Ca)3(Fe+++,Al)2(AsO4)4•11(H2O) |
| 10.900(8.10) | 100 | 3.770(23.58) | 80 | 7.630(11.59) | 50 | Abelsonite | Ni++C31H32N4 |
| 10.900(8.10) | 100 | 5.450(16.25) | 90 | 3.630(24.50) | 80 | Glaucocerinite | (Zn,Cu)5Al3(SO4)1.5(OH)16•9(H2O) |
| 10.900(8.10) | 100 | 5.460(16.22) | 60 | 3.660(24.30) | 50 | Woodwardite | Cu4Al2(SO4)(OH)12•2-4(H2O) |
| 10.920(8.09) | 100 | 3.630(24.50) | 100 | 5.460(16.22) | 80 | Priceite | Ca2B5O7(OH)5•H2O |
| 10.930(8.08) | 100 | 5.459(16.22) | 80 | 3.879(22.91) | 70 | Holdawayite | Mn++6(CO3)2(OH)7(Cl,OH) |
| 10.940(8.08) | 100 | 13.000(6.79) | 30 | 2.728(32.80) | 25 | Nafertisite | Na3(Fe++,Fe+++)6(Ti2Si12O34)(O,OH)7•2(H2O) |
| 10.960(8.06) | 100 | 2.562(34.99) | 90 | 2.663(33.63) | 80 | Osakaite | Zn4SO4(OH)6•5H2O |
| 10.960(8.06) | 100 | 2.663(33.63) | 90 | 3.229(27.60) | 80 | Osakaite | Zn4SO4(OH)6•5H2O |
| 10.980(8.05) | 100 | 5.539(15.99) | 60 | 3.674(24.20) | 50 | Nikischerite | NaFe++6Al3(SO4)2(OH)18(H2O)12 |
| 10.980(8.05) | 100 | 5.470(16.19) | 90 | 2.547(35.21) | 90 | Shigaite | Mn++7Al4(SO4)2(OH)22•8(H2O) |
| 10.980(8.05) | 100 | 2.547(35.21) | 90 | 5.470(16.19) | 90 | Shigaite | Mn++7Al4(SO4)2(OH)22•8(H2O) |
| 10.990(8.04) | 100 | 22.290(3.96) | 48 | 3.170(28.13) | 33 | Brinrobertsite | (Na,K,Ca)x(Al,Fe,Mg)4(Si,Al)8O20(OH)4•3.54(H2O) [x = 0.35, n = 3.54] |
| 11.000(8.03) | 100 | 5.360(16.53) | 50 | 3.680(24.16) | 40 | Hydrohonessite | Ni6Fe+++2(SO4)(OH)16•7(H2O) |
| 11.000(8.03) | 100 | 18.300(4.82) | 25 | 3.878(22.91) | 20 | Pushcharovskite | Cu(AsO3OH)•1.5(H2O) |
| 11.000(8.03) | 100 | 5.550(15.96) | 70 | 4.730(18.74) | 60 | Franconite | Na2Nb4O11•9(H2O) |
| 11.000(8.03) | 100 | 22.000(4.01) | 100 | 3.200(27.86) | 80 | Fahleite | Zn5CaFe+++2(AsO4)6•14(H2O) |
[ 1 ]