| dbo:abstract
|
- IHCH-7113 is a drug which acts as an agonist at the 5-HT2A serotonin receptor. It was derived by structural simplification of the 5-HT2A antagonist atypical antipsychotic drug lumateperone along with several related compounds such as IHCH-7079 and IHCH-7086, which were found to be nonhallucinogenic biased 5-HT2A agonists that were active in antidepressant assays but did not produce psychedelic-like responding in mice. IHCH-7113 however produced a head-twitch response comparable to that of DOI or LSD, which was blocked by the 5-HT2A antagonist MDL100907. (en)
|
| dbo:casNumber
| |
| dbo:pubchem
| |
| dbo:thumbnail
| |
| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 2550 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| dbo:wikiPageWikiLink
| |
| dbp:c
| |
| dbp:casNumber
| |
| dbp:drugName
| |
| dbp:h
| |
| dbp:iupacName
| |
| dbp:n
| |
| dbp:pubchem
| |
| dbp:smiles
|
- CN1CCN2[C@H]3CCNC[C@H]3C4=C2C1=CC=C4 (en)
|
| dbp:stdinchi
| |
| dbp:stdinchikey
|
- QLGUCSLWLPCOTR-RYUDHWBXSA-N (en)
|
| dbp:wikiPageUsesTemplate
| |
| dcterms:subject
| |
| rdf:type
| |
| rdfs:comment
|
- IHCH-7113 is a drug which acts as an agonist at the 5-HT2A serotonin receptor. It was derived by structural simplification of the 5-HT2A antagonist atypical antipsychotic drug lumateperone along with several related compounds such as IHCH-7079 and IHCH-7086, which were found to be nonhallucinogenic biased 5-HT2A agonists that were active in antidepressant assays but did not produce psychedelic-like responding in mice. IHCH-7113 however produced a head-twitch response comparable to that of DOI or LSD, which was blocked by the 5-HT2A antagonist MDL100907. (en)
|
| rdfs:label
| |
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| foaf:isPrimaryTopicOf
| |
| foaf:name
| |
| is dbo:wikiPageWikiLink
of | |
| is foaf:primaryTopic
of | |
